CAS No: 29584-42-7, Chemical Name: sulfur trioxide dimethylformamide complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 29584-42-7, sulfur trioxide dimethylformamide complex is provided by ChemNet.com

  ChemNet > CAS > 29584-42-7 sulfur trioxide dimethylformamide complex

29584-42-7 sulfur trioxide dimethylformamide complex

उत्पाद का नाम sulfur trioxide dimethylformamide complex
समानार्थी N,N-dimethylformamide-oxosulfane dioxide (1:1)
आणविक फार्मूला C3H7NO4S
आण्विक वजन 153.157
InChI InChI=1/C3H7NO.O3S/c1-4(2)3-5;1-4(2)3/h3H,1-2H3;
कैस रजिस्टी संख्या 29584-42-7
EINECS 249-701-5
आणविक संरचना 29584-42-7 sulfur trioxide dimethylformamide complex
गलनांक 155-158℃
उबलने का समय 153°C at 760 mmHg
फ्लैश प्वाइंट 57.8°C
खतरा प्रतीक
खतरे के कोड
सुरक्षा विवरण