ChemNet > CAS > 306934-95-2 5-phenyl-2-thienylboronic acid
306934-95-2 5-phenyl-2-thienylboronic acid
उत्पाद का नाम |
5-phenyl-2-thienylboronic acid |
समानार्थी |
(5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
आणविक फार्मूला |
C10H9BO2S |
आण्विक वजन |
204.0533 |
InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
कैस रजिस्टी संख्या |
306934-95-2 |
आणविक संरचना |
|
घनत्व |
1.29g/cm3 |
गलनांक |
146℃ |
उबलने का समय |
412.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.632 |
फ्लैश प्वाइंट |
203.5°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|