| उत्पाद का नाम |
डायथाइल थियोडिकार्बोनेट |
| समानार्थी |
थियोडिकार्बोनिक एसिड ((एचओ) सी (ओ) एससी (एस) (ओएच)), ओसी, ओसी'-डायथाइल एस्टर; एआई3-19742; एथिल ज़ैंथोजेन एथिल फॉर्मेट; एनएससी 403191; Xanthic एसिड, एथिल-, O-एथिल thiocarbonate के साथ anhydrosulfide; Xanthic एसिड, एथिल-, O-एथिल thiolcarbonate के साथ anhydrosulfide; कार्बोनिक एसिड, डिथियो-, ओ-एथिल थियोकार्बोनेट के साथ एनहाइड्रोसल्फाइड, ओ-एथिल एस्टर (8CI); डायथाइल थियोडिकार्बोनेट ((ओएच) सी (ओ) एससी (एस) (ओएच)); थियोडिकार्बोनिक एसिड ((एचओ) सी (ओ) एससी (एस) (ओएच)), डायथाइल एस्टर; थियोडिकार्बोनिक एसिड, डायथाइल एस्टर; हे, ओ-डायथाइल डाइथियोडिकार्बोनेट |
| अंग्रेजी नाम |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| आणविक फार्मूला |
C6H10O3S2 |
| आण्विक वजन |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| कैस रजिस्टी संख्या |
3278-35-1 |
| EINECS |
221-911-1 |
| आणविक संरचना |
|
| घनत्व |
1.242g/cm3 |
| उबलने का समय |
236°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.534 |
| फ्लैश प्वाइंट |
96.5°C |
| वाष्प का दबाव |
0.0487mmHg at 25°C |
|