ChemNet > CAS > 332-43-4 1-(2-chloroethyl)-4-fluorobenzene
332-43-4 1-(2-chloroethyl)-4-fluorobenzene
उत्पाद का नाम |
1-(2-chloroethyl)-4-fluorobenzene |
समानार्थी |
4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
आणविक फार्मूला |
C8H8ClF |
आण्विक वजन |
158.6005 |
InChI |
InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
कैस रजिस्टी संख्या |
332-43-4 |
EINECS |
206-364-9 |
आणविक संरचना |
|
घनत्व |
1.15g/cm3 |
उबलने का समय |
204.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.501 |
फ्लैश प्वाइंट |
79.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|