ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
उत्पाद का नाम |
3,5-Dimethylphenylacetonitrile |
समानार्थी |
3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
आणविक फार्मूला |
C10H11N |
आण्विक वजन |
145.201 |
InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
कैस रजिस्टी संख्या |
39101-54-7 |
EINECS |
254-292-1 |
आणविक संरचना |
|
घनत्व |
0.979g/cm3 |
उबलने का समय |
254.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.524 |
फ्लैश प्वाइंट |
117.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|