ChemNet > CAS > 4693-91-8 4-methoxyphenylacetyl chloride
4693-91-8 4-methoxyphenylacetyl chloride
उत्पाद का नाम |
4-methoxyphenylacetyl chloride |
समानार्थी |
Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
आणविक फार्मूला |
C9H9ClO2 |
आण्विक वजन |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
कैस रजिस्टी संख्या |
4693-91-8 |
आणविक संरचना |
|
घनत्व |
1.192g/cm3 |
उबलने का समय |
280.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.524 |
फ्लैश प्वाइंट |
100°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|