ChemNet > CAS > 502-50-1 4-Ketopimelic acid
502-50-1 4-Ketopimelic acid
| उत्पाद का नाम |
4-Ketopimelic acid |
| समानार्थी |
4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
| आणविक फार्मूला |
C7H8O5 |
| आण्विक वजन |
172.1365 |
| InChI |
InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| कैस रजिस्टी संख्या |
502-50-1 |
| EINECS |
207-941-8 |
| आणविक संरचना |
|
| गलनांक |
142-144℃ |
| उबलने का समय |
420.4°C at 760 mmHg |
| फ्लैश प्वाइंट |
222.2°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
