ChemNet > CAS > 58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
58161-35-6 N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide
| उत्पाद का नाम |
N1-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
| समानार्थी |
5-(Acetylamino)-1-indanone; 5-Acetamido-1-indanone; 5-Acetylamino-1-indanone; N-(1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
| आणविक फार्मूला |
C11H11NO2 |
| आण्विक वजन |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-7(13)12-9-3-4-10-8(6-9)2-5-11(10)14/h3-4,6H,2,5H2,1H3,(H,12,13) |
| कैस रजिस्टी संख्या |
58161-35-6 |
| आणविक संरचना |
|
| घनत्व |
1.278g/cm3 |
| गलनांक |
169℃ |
| उबलने का समय |
427.362°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.632 |
| फ्लैश प्वाइंट |
194.835°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
