ChemNet > CAS > 59463-56-8 cyanomethyl ethanethioate
59463-56-8 cyanomethyl ethanethioate
उत्पाद का नाम |
cyanomethyl ethanethioate |
समानार्थी |
S-(cyanomethyl) ethanethioate |
आणविक फार्मूला |
C4H5NOS |
आण्विक वजन |
115.1536 |
InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
कैस रजिस्टी संख्या |
59463-56-8 |
आणविक संरचना |
|
घनत्व |
1.162g/cm3 |
उबलने का समय |
198.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.487 |
फ्लैश प्वाइंट |
73.6°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|