ChemNet > CAS > 60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
उत्पाद का नाम |
3,4-Dimethoxyphenylacetic acid hydrazide |
समानार्थी |
3,4-Dimethoxyphenylacethydrazide~Homoveratric acid hydrazide; 2-(3,4-dimethoxyphenyl)acetohydrazide |
आणविक फार्मूला |
C10H14N2O3 |
आण्विक वजन |
210.2298 |
InChI |
InChI=1/C10H14N2O3/c1-14-8-4-3-7(5-9(8)15-2)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
कैस रजिस्टी संख्या |
60075-23-2 |
आणविक संरचना |
|
घनत्व |
1.168g/cm3 |
उबलने का समय |
420.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.538 |
फ्लैश प्वाइंट |
208°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|