ChemNet > CAS > 624-17-9 Diethyl azelate
624-17-9 Diethyl azelate
उत्पाद का नाम |
Diethyl azelate |
समानार्थी |
Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
आणविक फार्मूला |
C13H24O4 |
आण्विक वजन |
244.3273 |
InChI |
InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
कैस रजिस्टी संख्या |
624-17-9 |
EINECS |
210-833-3 |
आणविक संरचना |
|
घनत्व |
0.976g/cm3 |
उबलने का समय |
291.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.439 |
फ्लैश प्वाइंट |
129.2°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|