ChemNet > CAS > 626-27-7 Heptanoic anhydride
626-27-7 Heptanoic anhydride
| उत्पाद का नाम |
Heptanoic anhydride |
| समानार्थी |
Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
| आणविक फार्मूला |
C14H26O3 |
| आण्विक वजन |
242.3544 |
| InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
| कैस रजिस्टी संख्या |
626-27-7 |
| EINECS |
210-940-5 |
| आणविक संरचना |
|
| घनत्व |
0.931g/cm3 |
| गलनांक |
-12℃ |
| उबलने का समय |
269.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.44 |
| फ्लैश प्वाइंट |
129.9°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
