ChemNet > CAS > 62936-23-6 5-Chlorovanillic acid
62936-23-6 5-Chlorovanillic acid
उत्पाद का नाम |
5-Chlorovanillic acid |
समानार्थी |
5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
आणविक फार्मूला |
C8H7ClO4 |
आण्विक वजन |
202.5918 |
InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
कैस रजिस्टी संख्या |
62936-23-6 |
EINECS |
263-766-7 |
आणविक संरचना |
|
घनत्व |
1.485g/cm3 |
गलनांक |
241-243℃ |
उबलने का समय |
352.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.599 |
फ्लैश प्वाइंट |
166.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|