ChemNet > CAS > 79676-56-5 2-(Difluoromethylthio)benzoic acid
79676-56-5 2-(Difluoromethylthio)benzoic acid
उत्पाद का नाम |
2-(Difluoromethylthio)benzoic acid |
समानार्थी |
2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
आणविक फार्मूला |
C8H5ClF2OS |
आण्विक वजन |
222.6395 |
InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
कैस रजिस्टी संख्या |
79676-56-5 |
आणविक संरचना |
|
घनत्व |
1.42g/cm3 |
उबलने का समय |
236.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.541 |
फ्लैश प्वाइंट |
96.6°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|