ChemNet > CAS > 818-38-2 diethyl glutarate
818-38-2 diethyl glutarate
| उत्पाद का नाम |
diethyl glutarate |
| समानार्थी |
Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| आणविक फार्मूला |
C9H16O4 |
| आण्विक वजन |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| कैस रजिस्टी संख्या |
818-38-2 |
| EINECS |
212-451-2 |
| आणविक संरचना |
|
| घनत्व |
1.022g/cm3 |
| उबलने का समय |
236.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.427 |
| फ्लैश प्वाइंट |
96.1°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
