ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
उत्पाद का नाम |
2-Acetyl-3-chlorothiophene |
समानार्थी |
1-(3-chlorothiophen-2-yl)ethanone |
आणविक फार्मूला |
C6H5ClOS |
आण्विक वजन |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
कैस रजिस्टी संख्या |
89581-82-8 |
आणविक संरचना |
|
घनत्व |
1.312g/cm3 |
उबलने का समय |
219.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.559 |
फ्लैश प्वाइंट |
86.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|