ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
| उत्पाद का नाम |
Diallyl maleate |
| समानार्थी |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
| आणविक फार्मूला |
C10H12O4 |
| आण्विक वजन |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
| कैस रजिस्टी संख्या |
999-21-3 |
| EINECS |
213-658-0 |
| आणविक संरचना |
|
| घनत्व |
1.064g/cm3 |
| उबलने का समय |
263.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.469 |
| फ्लैश प्वाइंट |
124.6°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
