ChemNet > CAS > 999-21-3 Diallyl maleate
999-21-3 Diallyl maleate
उत्पाद का नाम |
Diallyl maleate |
समानार्थी |
Diallyl maleate, (Maleic acid diallyl ester); Maleic acid diallyl ester; diprop-2-en-1-yl (2Z)-but-2-enedioate |
आणविक फार्मूला |
C10H12O4 |
आण्विक वजन |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-6H,1-2,7-8H2/b6-5- |
कैस रजिस्टी संख्या |
999-21-3 |
EINECS |
213-658-0 |
आणविक संरचना |
|
घनत्व |
1.064g/cm3 |
उबलने का समय |
263.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.469 |
फ्लैश प्वाइंट |
124.6°C |
खतरा प्रतीक |
|
खतरे के कोड |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|