ChemNet > CAS > 10241-97-1 5-methylindole-2-carboxylic acid
10241-97-1 5-methylindole-2-carboxylic acid
| نام محصول |
5-methylindole-2-carboxylic acid |
| مترادف |
5-methyl-1H-indole-2-carboxylic acid |
| میدان مغناطیسی |
C10H9NO2 |
| وزن مولکولی |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
| شماره سیایاس |
10241-97-1 |
| ساختار مولکولی |
|
| تراکم |
1.34g/cm3 |
| نقطه غلیان |
421.2°C at 760 mmHg |
| ضریب شکست |
1.696 |
| نقطه اشتعال |
208.5°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
