ChemNet > CAS > 108210-73-7 Bifeprofen
108210-73-7 Bifeprofen
نام محصول |
Bifeprofen |
مترادف |
Bifeprofen [INN]; (+-)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methylpiperazine; UNII-9973I7EX5X; ( -)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methyllpiperazine; 2-(4-methylpiperazin-1-yl)-2-oxoethyl 2-(2'-chlorobiphenyl-4-yl)propanoate |
میدان مغناطیسی |
C22H25ClN2O3 |
وزن مولکولی |
400.8985 |
InChI |
InChI=1/C22H25ClN2O3/c1-16(22(27)28-15-21(26)25-13-11-24(2)12-14-25)17-7-9-18(10-8-17)19-5-3-4-6-20(19)23/h3-10,16H,11-15H2,1-2H3 |
شماره سیایاس |
108210-73-7 |
ساختار مولکولی |
|
تراکم |
1.209g/cm3 |
نقطه غلیان |
543.8°C at 760 mmHg |
ضریب شکست |
1.572 |
نقطه اشتعال |
282.7°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|