ChemNet > CAS > 114152-19-1 2,3,6-trifluorobenzyl alcohol
114152-19-1 2,3,6-trifluorobenzyl alcohol
| نام محصول |
2,3,6-trifluorobenzyl alcohol |
| میدان مغناطیسی |
C7H5F3O |
| وزن مولکولی |
162.1092 |
| InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
| شماره سیایاس |
114152-19-1 |
| ساختار مولکولی |
|
| تراکم |
1.398g/cm3 |
| نقطه ذوب |
43-45℃ |
| نقطه غلیان |
187°C at 760 mmHg |
| ضریب شکست |
1.476 |
| نقطه اشتعال |
80.8°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
