ChemNet > CAS > 120800-52-4 6-morpholinonicotinic acid
120800-52-4 6-morpholinonicotinic acid
| نام محصول |
6-morpholinonicotinic acid |
| مترادف |
6-morpholinopyridine-3-carboxylic acid |
| میدان مغناطیسی |
C10H12N2O3 |
| وزن مولکولی |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14) |
| شماره سیایاس |
120800-52-4 |
| ساختار مولکولی |
|
| تراکم |
1.314g/cm3 |
| نقطه ذوب |
261℃ |
| نقطه غلیان |
446.074°C at 760 mmHg |
| ضریب شکست |
1.585 |
| نقطه اشتعال |
223.578°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
