ChemNet > CAS > 13221-86-8 2,4-Dihydroxybenzhydrazide
13221-86-8 2,4-Dihydroxybenzhydrazide
نام محصول |
2,4-Dihydroxybenzhydrazide |
مترادف |
2,4-Dihydroxybenzoic acid,hydrazide; 2,4-dihydroxybenzohydrazide |
میدان مغناطیسی |
C7H8N2O3 |
وزن مولکولی |
168.15 |
InChI |
InChI=1/C7H8N2O3/c8-9-7(12)5-2-1-4(10)3-6(5)11/h1-3,10-11H,8H2,(H,9,12) |
شماره سیایاس |
13221-86-8 |
ساختار مولکولی |
|
تراکم |
1.477g/cm3 |
نقطه ذوب |
247-250℃ |
ضریب شکست |
1.67 |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|