ChemNet > CAS > 14496-35-6 N,N-Dimethyl-5-methylfurfurylamine
14496-35-6 N,N-Dimethyl-5-methylfurfurylamine
| نام محصول |
N,N-Dimethyl-5-methylfurfurylamine |
| میدان مغناطیسی |
C8H13NO |
| وزن مولکولی |
139.1949 |
| InChI |
InChI=1/C8H13NO/c1-7-4-5-8(10-7)6-9(2)3/h4-5H,6H2,1-3H3 |
| شماره سیایاس |
14496-35-6 |
| ساختار مولکولی |
|
| تراکم |
0.959g/cm3 |
| نقطه غلیان |
150.5°C at 760 mmHg |
| ضریب شکست |
1.48 |
| نقطه اشتعال |
44.8°C |
| خطر نمادها |
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
