ChemNet > CAS > 15102-42-8 2,3-Dibromopropionamide
15102-42-8 2,3-Dibromopropionamide
| نام محصول |
2,3-Dibromopropionamide |
| مترادف |
Propanamide, 2,3-dibromo-; 2,3-dibromopropanamide |
| میدان مغناطیسی |
C3H5Br2NO |
| وزن مولکولی |
230.8859 |
| InChI |
InChI=1/C3H5Br2NO/c4-1-2(5)3(6)7/h2H,1H2,(H2,6,7) |
| شماره سیایاس |
15102-42-8 |
| تعداد کمیسیون اروپایی |
239-153-5 |
| ساختار مولکولی |
|
| تراکم |
2.186g/cm3 |
| نقطه غلیان |
315.6°C at 760 mmHg |
| ضریب شکست |
1.575 |
| نقطه اشتعال |
144.7°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
