ChemNet > CAS > 1575-74-2 2-Methylpent-4-enoic acid
1575-74-2 2-Methylpent-4-enoic acid
نام محصول |
2-Methylpent-4-enoic acid |
مترادف |
2-Methyl-4-pentenoic acid; (2S)-2-methylpent-4-enoate; (2R)-2-methylpent-4-enoate |
میدان مغناطیسی |
C6H9O2 |
وزن مولکولی |
113.135 |
InChI |
InChI=1/C6H10O2/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3,(H,7,8)/p-1/t5-/m1/s1 |
شماره سیایاس |
1575-74-2 |
تعداد کمیسیون اروپایی |
216-404-7 |
ساختار مولکولی |
|
نقطه غلیان |
190.6°C at 760 mmHg |
نقطه اشتعال |
88.1°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|