ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
نام محصول |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
مترادف |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
میدان مغناطیسی |
C6H2BF5O2 |
وزن مولکولی |
211.8819 |
InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
شماره سیایاس |
1582-24-7 |
ساختار مولکولی |
|
تراکم |
1.61g/cm3 |
نقطه غلیان |
244°C at 760 mmHg |
ضریب شکست |
1.429 |
نقطه اشتعال |
101.4°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|