ChemNet > CAS > 170880-96-3 2-Fluorophenylglyoxal hydrate
170880-96-3 2-Fluorophenylglyoxal hydrate
نام محصول |
2-Fluorophenylglyoxal hydrate |
مترادف |
(2-fluorophenyl)(oxo)acetaldehyde hydrate; 2-(2-fluorophenyl)-2-oxoacetaldehyde |
میدان مغناطیسی |
C8H7FO3 |
وزن مولکولی |
170.1378 |
InChI |
InChI=1/C8H5FO2.H2O/c9-7-4-2-1-3-6(7)8(11)5-10;/h1-5H;1H2 |
شماره سیایاس |
170880-96-3 |
ساختار مولکولی |
|
نقطه غلیان |
212.8°C at 760 mmHg |
نقطه اشتعال |
79.7°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|