ChemNet > CAS > 1711-10-0 3-iodobenzoyl chloride
1711-10-0 3-iodobenzoyl chloride
نام محصول |
3-iodobenzoyl chloride |
میدان مغناطیسی |
C7H4ClIO |
وزن مولکولی |
266.46 |
InChI |
InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H |
شماره سیایاس |
1711-10-0 |
تعداد کمیسیون اروپایی |
216-979-4 |
ساختار مولکولی |
|
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|