ChemNet > CAS > 1766-76-3 decafluorobenzhydrol
1766-76-3 decafluorobenzhydrol
نام محصول |
decafluorobenzhydrol |
مترادف |
Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
میدان مغناطیسی |
C13H2F10O |
وزن مولکولی |
364.1384 |
InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
شماره سیایاس |
1766-76-3 |
تعداد کمیسیون اروپایی |
217-185-0 |
ساختار مولکولی |
|
تراکم |
1.74g/cm3 |
نقطه ذوب |
76-80℃ |
نقطه غلیان |
265.2°C at 760 mmHg |
ضریب شکست |
1.457 |
نقطه اشتعال |
114.2°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|