ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
نام محصول |
Methyl hydrogen isophthalate |
مترادف |
Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate |
میدان مغناطیسی |
C9H8O4 |
وزن مولکولی |
180.1574 |
InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
شماره سیایاس |
1877-71-0 |
ساختار مولکولی |
|
تراکم |
1.288g/cm3 |
نقطه ذوب |
194-196℃ |
نقطه غلیان |
339.3°C at 760 mmHg |
ضریب شکست |
1.556 |
نقطه اشتعال |
139.6°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|