ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
| نام محصول |
(4-Methoxy-2-methylphenyl)boronic acid |
| مترادف |
4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
| میدان مغناطیسی |
C8H11BO3 |
| وزن مولکولی |
165.9821 |
| InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
| شماره سیایاس |
208399-66-0 |
| ساختار مولکولی |
|
| تراکم |
1.14g/cm3 |
| نقطه غلیان |
327.1°C at 760 mmHg |
| ضریب شکست |
1.52 |
| نقطه اشتعال |
151.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
