ChemNet > CAS > 21055-37-8 Methyl 2-isothiocyanatoacetate
21055-37-8 Methyl 2-isothiocyanatoacetate
نام محصول |
Methyl 2-isothiocyanatoacetate |
مترادف |
2-Isothiocyanatoacetic acid methyl ester; thyl 2-isothiocyanatoacetate; methyl N-(thioxomethylidene)glycinate |
میدان مغناطیسی |
C4H5NO2S |
وزن مولکولی |
131.153 |
InChI |
InChI=1/C4H5NO2S/c1-7-4(6)2-5-3-8/h2H2,1H3 |
شماره سیایاس |
21055-37-8 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه غلیان |
193.9°C at 760 mmHg |
ضریب شکست |
1.503 |
نقطه اشتعال |
71.1°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|