ChemNet > CAS > 22047-88-7 2-Benzyloxyphenylacetic acid
22047-88-7 2-Benzyloxyphenylacetic acid
نام محصول |
2-Benzyloxyphenylacetic acid |
مترادف |
[2-(phenoxymethyl)phenyl]acetic acid |
میدان مغناطیسی |
C15H14O3 |
وزن مولکولی |
242.2699 |
InChI |
InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
شماره سیایاس |
22047-88-7 |
ساختار مولکولی |
|
تراکم |
1.201g/cm3 |
نقطه غلیان |
408.9°C at 760 mmHg |
ضریب شکست |
1.595 |
نقطه اشتعال |
154.1°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|