ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
نام محصول |
3,4-difluoropropiophenone |
مترادف |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
میدان مغناطیسی |
C9H8F2O |
وزن مولکولی |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
شماره سیایاس |
23384-72-7 |
تعداد کمیسیون اروپایی |
245-627-2 |
ساختار مولکولی |
|
تراکم |
1.166g/cm3 |
نقطه غلیان |
225°C at 760 mmHg |
ضریب شکست |
1.472 |
نقطه اشتعال |
84.8°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|