ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
| نام محصول |
3,4-difluoropropiophenone |
| مترادف |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
| میدان مغناطیسی |
C9H8F2O |
| وزن مولکولی |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
| شماره سیایاس |
23384-72-7 |
| تعداد کمیسیون اروپایی |
245-627-2 |
| ساختار مولکولی |
|
| تراکم |
1.166g/cm3 |
| نقطه غلیان |
225°C at 760 mmHg |
| ضریب شکست |
1.472 |
| نقطه اشتعال |
84.8°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
