ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| نام محصول |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| مترادف |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| میدان مغناطیسی |
C11H15NO3 |
| وزن مولکولی |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| شماره سیایاس |
2386-26-7 |
| ساختار مولکولی |
|
| تراکم |
1.125g/cm3 |
| نقطه ذوب |
139℃ |
| نقطه غلیان |
348.9°C at 760 mmHg |
| ضریب شکست |
1.517 |
| نقطه اشتعال |
164.8°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
