ChemNet > CAS > 2567-29-5 Bromoethylbiphenyl
2567-29-5 Bromoethylbiphenyl
| نام محصول |
Bromoethylbiphenyl |
| مترادف |
4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
| میدان مغناطیسی |
C13H11Br |
| وزن مولکولی |
247.1304 |
| InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| شماره سیایاس |
2567-29-5 |
| ساختار مولکولی |
|
| تراکم |
1.341g/cm3 |
| نقطه ذوب |
86℃ |
| نقطه غلیان |
333.4°C at 760 mmHg |
| ضریب شکست |
1.605 |
| نقطه اشتعال |
161.3°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
