ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
نام محصول |
2,3-Difluoro-4-methylbenzoic acid |
مترادف |
2,3-Difluoro-p-toluic acid |
میدان مغناطیسی |
C8H6F2O2 |
وزن مولکولی |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
شماره سیایاس |
261763-37-5 |
ساختار مولکولی |
|
تراکم |
1.359g/cm3 |
نقطه غلیان |
274°C at 760 mmHg |
ضریب شکست |
1.511 |
نقطه اشتعال |
119.5°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|