ChemNet > CAS > 2873-74-7 Glutaryl dichloride
2873-74-7 Glutaryl dichloride
نام محصول |
Glutaryl dichloride |
مترادف |
Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
میدان مغناطیسی |
C5H6Cl2O2 |
وزن مولکولی |
169.0059 |
InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
شماره سیایاس |
2873-74-7 |
تعداد کمیسیون اروپایی |
220-711-1 |
ساختار مولکولی |
|
تراکم |
1.319g/cm3 |
نقطه غلیان |
217.8°C at 760 mmHg |
ضریب شکست |
1.458 |
نقطه اشتعال |
106.7°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|