ChemNet > CAS > 29418-67-5 2-Bromobenzhydrazide
29418-67-5 2-Bromobenzhydrazide
| نام محصول |
2-Bromobenzhydrazide |
| مترادف |
2-Bromobenzohydrazide |
| میدان مغناطیسی |
C7H7BrN2O |
| وزن مولکولی |
215.0473 |
| InChI |
InChI=1/C7H7BrN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| شماره سیایاس |
29418-67-5 |
| تعداد کمیسیون اروپایی |
249-614-2 |
| ساختار مولکولی |
|
| تراکم |
1.615g/cm3 |
| نقطه غلیان |
367.2°C at 760 mmHg |
| ضریب شکست |
1.615 |
| نقطه اشتعال |
175.9°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
