ChemNet > CAS > 29681-45-6 Methyl 5-methylnicotinate
29681-45-6 Methyl 5-methylnicotinate
| نام محصول |
Methyl 5-methylnicotinate |
| مترادف |
Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
| میدان مغناطیسی |
C8H9NO2 |
| وزن مولکولی |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
| شماره سیایاس |
29681-45-6 |
| ساختار مولکولی |
|
| تراکم |
1.104g/cm3 |
| نقطه غلیان |
228.5°C at 760 mmHg |
| ضریب شکست |
1.51 |
| نقطه اشتعال |
92°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
