ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| نام محصول |
2-Acetyl-5-iodothiophene |
| مترادف |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| میدان مغناطیسی |
C6H5IOS |
| وزن مولکولی |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| شماره سیایاس |
30955-94-3 |
| ساختار مولکولی |
|
| تراکم |
1.902g/cm3 |
| نقطه غلیان |
306.2°C at 760 mmHg |
| ضریب شکست |
1.637 |
| نقطه اشتعال |
139°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
