ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
نام محصول |
4,5-Dinitro-o-phenylenediamine |
مترادف |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
میدان مغناطیسی |
C6H6N4O4 |
وزن مولکولی |
198.1362 |
InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
شماره سیایاس |
32690-28-1 |
ساختار مولکولی |
|
تراکم |
1.683g/cm3 |
نقطه ذوب |
213℃ |
نقطه غلیان |
541.1°C at 760 mmHg |
ضریب شکست |
1.747 |
نقطه اشتعال |
281°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|