ChemNet > CAS > 342002-82-8 4-ایزوپروپروکسی کربونیل فنیل بورونیک اسید؛ {4-[(1-methylethoxy)carbonyl]phenyl}اسید بورونیک؛
342002-82-8 4-ایزوپروپروکسی کربونیل فنیل بورونیک اسید؛ {4-[(1-methylethoxy)carbonyl]phenyl}اسید بورونیک؛
| نام محصول |
4-ایزوپروپروکسی کربونیل فنیل بورونیک اسید؛ {4-[(1-methylethoxy)carbonyl]phenyl}اسید بورونیک؛ |
| نام انگلیسی |
4-Isopropoxycarbonylphenylboronic acid;{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
| میدان مغناطیسی |
C10H13BO4 |
| وزن مولکولی |
208.0188 |
| InChI |
InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
| شماره سیایاس |
342002-82-8 |
| ساختار مولکولی |
|
| تراکم |
1.17g/cm3 |
| نقطه ذوب |
111℃ |
| نقطه غلیان |
359°C at 760 mmHg |
| ضریب شکست |
1.519 |
| نقطه اشتعال |
170.9°C |
| فشار بخار |
8.86E-06mmHg at 25°C |
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|