ChemNet > CAS > 355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
نام محصول |
4-(isopropylamino)-3-nitrobenzonitrile |
مترادف |
4-[(1-methylethyl)amino]-3-nitrobenzonitrile |
میدان مغناطیسی |
C10H11N3O2 |
وزن مولکولی |
205.2132 |
InChI |
InChI=1/C10H11N3O2/c1-7(2)12-9-4-3-8(6-11)5-10(9)13(14)15/h3-5,7,12H,1-2H3 |
شماره سیایاس |
355022-17-2 |
ساختار مولکولی |
|
تراکم |
1.21g/cm3 |
نقطه ذوب |
113℃ |
نقطه غلیان |
347.4°C at 760 mmHg |
ضریب شکست |
1.56 |
نقطه اشتعال |
163.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|