ChemNet > CAS > 37868-26-1 2-Indanylacetic acid
37868-26-1 2-Indanylacetic acid
نام محصول |
2-Indanylacetic acid |
مترادف |
2,3-dihydro-1H-inden-1-ylacetic acid |
میدان مغناطیسی |
C11H12O2 |
وزن مولکولی |
176.2118 |
InChI |
InChI=1/C11H12O2/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-7H2,(H,12,13) |
شماره سیایاس |
37868-26-1 |
ساختار مولکولی |
|
تراکم |
1.169g/cm3 |
نقطه غلیان |
343.28°C at 760 mmHg |
ضریب شکست |
1.568 |
نقطه اشتعال |
240.264°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|