ChemNet > CAS > 40020-05-1 4,6-dichloro-3-phenylpyridazine
40020-05-1 4,6-dichloro-3-phenylpyridazine
نام محصول |
4,6-dichloro-3-phenylpyridazine |
میدان مغناطیسی |
C10H6Cl2N2 |
وزن مولکولی |
225.074 |
InChI |
InChI=1/C10H6Cl2N2/c11-8-6-9(12)13-14-10(8)7-4-2-1-3-5-7/h1-6H |
شماره سیایاس |
40020-05-1 |
ساختار مولکولی |
|
تراکم |
1.363g/cm3 |
نقطه ذوب |
83℃ |
نقطه غلیان |
381.4°C at 760 mmHg |
ضریب شکست |
1.604 |
نقطه اشتعال |
216.4°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|