ChemNet > CAS > 40228-90-8 7-Phenylheptanoic acid
40228-90-8 7-Phenylheptanoic acid
| نام محصول |
7-Phenylheptanoic acid |
| میدان مغناطیسی |
C13H18O2 |
| وزن مولکولی |
206.2808 |
| InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
| شماره سیایاس |
40228-90-8 |
| ساختار مولکولی |
|
| تراکم |
1.034g/cm3 |
| نقطه غلیان |
356.5°C at 760 mmHg |
| ضریب شکست |
1.519 |
| نقطه اشتعال |
253.5°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
