ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
| نام محصول |
4-Bromo-3-methylbenzonitrile |
| مترادف |
4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
| میدان مغناطیسی |
C8H6BrN |
| وزن مولکولی |
196.0439 |
| InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| شماره سیایاس |
41963-20-6 |
| ساختار مولکولی |
|
| تراکم |
1.51g/cm3 |
| نقطه غلیان |
265°C at 760 mmHg |
| ضریب شکست |
1.59 |
| نقطه اشتعال |
114.1°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
