ChemNet > CAS > 4458-33-7 دی-ان-بوتیلثیلامین؛ N-اتیلدی بوتیلامین؛ N-butyl-N-اتیل بوتان-1-امین؛
4458-33-7 دی-ان-بوتیلثیلامین؛ N-اتیلدی بوتیلامین؛ N-butyl-N-اتیل بوتان-1-امین؛
نام محصول |
دی-ان-بوتیلثیلامین؛ N-اتیلدی بوتیلامین؛ N-butyl-N-اتیل بوتان-1-امین؛ |
نام انگلیسی |
Di-n-butylethylamine;N-Ethyldibutylamine; N-butyl-N-ethylbutan-1-amine |
میدان مغناطیسی |
C10H23N |
وزن مولکولی |
157.2963 |
InChI |
InChI=1/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3 |
شماره سیایاس |
4458-33-7 |
تعداد کمیسیون اروپایی |
224-711-2 |
ساختار مولکولی |
|
تراکم |
0.783g/cm3 |
نقطه غلیان |
182.8°C at 760 mmHg |
ضریب شکست |
1.432 |
نقطه اشتعال |
52.6°C |
فشار بخار |
0.795mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|