ChemNet > CAS > 4787-77-3 2-(1-Pyrrolidino)phenol
4787-77-3 2-(1-Pyrrolidino)phenol
نام محصول |
2-(1-Pyrrolidino)phenol |
مترادف |
2-Pyrrolidinophenol, [1-(2-Hydroxyphenyl)pyrrolidine]; 1-(2-Hydroxyphenyl)pyrrolidine; 2-pyrrolidin-1-ylphenol |
میدان مغناطیسی |
C10H13NO |
وزن مولکولی |
163.2163 |
InChI |
InChI=1/C10H13NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-2,5-6,12H,3-4,7-8H2 |
شماره سیایاس |
4787-77-3 |
ساختار مولکولی |
|
تراکم |
1.146g/cm3 |
نقطه غلیان |
279.1°C at 760 mmHg |
ضریب شکست |
1.594 |
نقطه اشتعال |
139.6°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|